About 1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride
1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride (PubChem CID 171351720) has the molecular formula C22H20Cl2N2
and a molecular weight of 383.32 g/mol. Its IUPAC name is 1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride.
Molecular Properties
| Compound Name | 1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride |
| PubChem CID | 171351720 |
| Molecular Formula | C22H20Cl2N2 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride |
| SMILES | C[n+]1ccc(-c2ccc3cc(-c4cc[n+](C)cc4)ccc3c2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C22H20N2.2ClH/c1-23-11-7-17(8-12-23)19-3-5-22-16-20(4-6-21(22)15-19)18-9-13-24(2)14-10-18;;/h3-16H,1-2H3;2*1H/q+2;;/p-2 |
| InChIKey | XLSYPVMZPMEPRE-UHFFFAOYSA-L |
| XLogP | -2.17 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride?
The IUPAC name of 1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride (CID 171351720) is 1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride.
What is the SMILES notation for 1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride?
The canonical SMILES for 1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride is C[n+]1ccc(-c2ccc3cc(-c4cc[n+](C)cc4)ccc3c2)cc1.[Cl-].[Cl-].
What is the InChIKey of 1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride?
The InChIKey is XLSYPVMZPMEPRE-UHFFFAOYSA-L. The full InChI is InChI=1S/C22H20N2.2ClH/c1-23-11-7-17(8-12-23)19-3-5-22-16-20(4-6-21(22)15-19)18-9-13-24(2)14-10-18;;/h3-16H,1-2H3;2*1H/q+2;;/p-2.
What are the key properties of 1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride?
1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride has a molecular weight of 383.32 g/mol, XLogP of -2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[6-(1-methylpyridin-1-ium-4-yl)naphthalen-2-yl]pyridin-1-ium dichloride is sourced from PubChem (CID 171351720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).