About 6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile
6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile (PubChem CID 171351992) has the molecular formula C18H17Cl2N5O
and a molecular weight of 390.27 g/mol. Its IUPAC name is 6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile.
Molecular Properties
| Compound Name | 6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile |
| PubChem CID | 171351992 |
| Molecular Formula | C18H17Cl2N5O |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile |
| SMILES | N#Cc1nc(Cc2ccc(Cl)c(Cl)c2)c2ncn(CCCCCO)c2n1 |
| InChI | InChI=1S/C18H17Cl2N5O/c19-13-5-4-12(8-14(13)20)9-15-17-18(24-16(10-21)23-15)25(11-22-17)6-2-1-3-7-26/h4-5,8,11,26H,1-3,6-7,9H2 |
| InChIKey | SRIDDOLPSXGHPB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile?
The IUPAC name of 6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile (CID 171351992) is 6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile.
What is the SMILES notation for 6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile?
The canonical SMILES for 6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile is N#Cc1nc(Cc2ccc(Cl)c(Cl)c2)c2ncn(CCCCCO)c2n1.
What is the InChIKey of 6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile?
The InChIKey is SRIDDOLPSXGHPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2N5O/c19-13-5-4-12(8-14(13)20)9-15-17-18(24-16(10-21)23-15)25(11-22-17)6-2-1-3-7-26/h4-5,8,11,26H,1-3,6-7,9H2.
What are the key properties of 6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile?
6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile has a molecular weight of 390.27 g/mol, XLogP of 3.76, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3,4-dichlorophenyl)methyl]-9-(5-hydroxypentyl)purine-2-carbonitrile is sourced from PubChem (CID 171351992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).