C17H25ClNO9S+ — CID 171352122
(2R,3S,4S)-1-[(2S)-2-hydroxy-2-[(4S,5R)-5-hydroxy-2-(4-nitrophenyl)-1,3-dioxan-4-yl]ethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol;hydrochloride (PubChem CID 171352122) has the molecular formula C17H25ClNO9S+ and a molecular weight of 454.91 g/mol. Its IUPAC name is (2R,3S,4S)-1-[(2S)-2-hydroxy-2-[(4S,5R)-5-hydroxy-2-(4-nitrophenyl)-1,3-dioxan-4-yl]ethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol;hydrochloride.
| Compound Name | (2R,3S,4S)-1-[(2S)-2-hydroxy-2-[(4S,5R)-5-hydroxy-2-(4-nitrophenyl)-1,3-dioxan-4-yl]ethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol;hydrochloride |
|---|---|
| PubChem CID | 171352122 |
| Molecular Formula | C17H25ClNO9S+ |
| Molecular Weight | 454.91 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (2R,3S,4S)-1-[(2S)-2-hydroxy-2-[(4S,5R)-5-hydroxy-2-(4-nitrophenyl)-1,3-dioxan-4-yl]ethyl]-2-(hydroxymethyl)thiolan-1-ium-3,4-diol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(C2OC[C@@H](O)[C@@H]([C@H](O)C[S+]3C[C@@H](O)[C@H](O)[C@H]3CO)O2)cc1 |
| InChI | InChI=1S/C17H24NO9S.ClH/c19-5-14-15(23)12(21)7-28(14)8-13(22)16-11(20)6-26-17(27-16)9-1-3-10(4-2-9)18(24)25;/h1-4,11-17,19-23H,5-8H2;1H/q+1;/t11-,12-,13-,14-,15+,16+,17?,28?;/m1./s1 |
| InChIKey | OEHZQVWXEWULQX-HKQIUAKMSA-N |
| XLogP | -1.13 |
| TPSA | 162.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.91 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|