About (3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone
(3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone (PubChem CID 171352306) has the molecular formula C23H23Cl2N3O3
and a molecular weight of 460.36 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone |
| PubChem CID | 171352306 |
| Molecular Formula | C23H23Cl2N3O3 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | (3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone |
| SMILES | COc1ccc2nc(CN3CCN(C(=O)c4ccc(Cl)c(Cl)c4)CC3)cc(OC)c2c1 |
| InChI | InChI=1S/C23H23Cl2N3O3/c1-30-17-4-6-21-18(13-17)22(31-2)12-16(26-21)14-27-7-9-28(10-8-27)23(29)15-3-5-19(24)20(25)11-15/h3-6,11-13H,7-10,14H2,1-2H3 |
| InChIKey | GMMVNMFMWBDCAV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone?
The IUPAC name of (3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone (CID 171352306) is (3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone.
What is the SMILES notation for (3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone?
The canonical SMILES for (3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone is COc1ccc2nc(CN3CCN(C(=O)c4ccc(Cl)c(Cl)c4)CC3)cc(OC)c2c1.
What is the InChIKey of (3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone?
The InChIKey is GMMVNMFMWBDCAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23Cl2N3O3/c1-30-17-4-6-21-18(13-17)22(31-2)12-16(26-21)14-27-7-9-28(10-8-27)23(29)15-3-5-19(24)20(25)11-15/h3-6,11-13H,7-10,14H2,1-2H3.
What are the key properties of (3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone?
(3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone has a molecular weight of 460.36 g/mol, XLogP of 4.52, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl)-[4-[(4,6-dimethoxyquinolin-2-yl)methyl]piperazin-1-yl]methanone is sourced from PubChem (CID 171352306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).