About 5-amino-2-(4-phenylbuta-1,3-diynyl)phenol
5-amino-2-(4-phenylbuta-1,3-diynyl)phenol (PubChem CID 171352362) has the molecular formula C16H11NO
and a molecular weight of 233.27 g/mol. Its IUPAC name is 5-amino-2-(4-phenylbuta-1,3-diynyl)phenol.
Molecular Properties
| Compound Name | 5-amino-2-(4-phenylbuta-1,3-diynyl)phenol |
| PubChem CID | 171352362 |
| Molecular Formula | C16H11NO |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 5-amino-2-(4-phenylbuta-1,3-diynyl)phenol |
| SMILES | Nc1ccc(C#CC#Cc2ccccc2)c(O)c1 |
| InChI | InChI=1S/C16H11NO/c17-15-11-10-14(16(18)12-15)9-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,10-12,18H,17H2 |
| InChIKey | NHMMOZMRZOLFGT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-(4-phenylbuta-1,3-diynyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(4-phenylbuta-1,3-diynyl)phenol?
The IUPAC name of 5-amino-2-(4-phenylbuta-1,3-diynyl)phenol (CID 171352362) is 5-amino-2-(4-phenylbuta-1,3-diynyl)phenol.
What is the SMILES notation for 5-amino-2-(4-phenylbuta-1,3-diynyl)phenol?
The canonical SMILES for 5-amino-2-(4-phenylbuta-1,3-diynyl)phenol is Nc1ccc(C#CC#Cc2ccccc2)c(O)c1.
What is the InChIKey of 5-amino-2-(4-phenylbuta-1,3-diynyl)phenol?
The InChIKey is NHMMOZMRZOLFGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NO/c17-15-11-10-14(16(18)12-15)9-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,10-12,18H,17H2.
What are the key properties of 5-amino-2-(4-phenylbuta-1,3-diynyl)phenol?
5-amino-2-(4-phenylbuta-1,3-diynyl)phenol has a molecular weight of 233.27 g/mol, XLogP of 2.38, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(4-phenylbuta-1,3-diynyl)phenol is sourced from PubChem (CID 171352362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).