C23H21N3O9S — CID 171352456
1-(2-oxobutyl)-3-[6-(3,6,7-trihydroxy-5,8-dimethoxy-4-oxochromen-2-yl)-1,3-benzothiazol-2-yl]urea (PubChem CID 171352456) has the molecular formula C23H21N3O9S and a molecular weight of 515.50 g/mol. Its IUPAC name is 1-(2-oxobutyl)-3-[6-(3,6,7-trihydroxy-5,8-dimethoxy-4-oxochromen-2-yl)-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-(2-oxobutyl)-3-[6-(3,6,7-trihydroxy-5,8-dimethoxy-4-oxochromen-2-yl)-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 171352456 |
| Molecular Formula | C23H21N3O9S |
| Molecular Weight | 515.50 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 1-(2-oxobutyl)-3-[6-(3,6,7-trihydroxy-5,8-dimethoxy-4-oxochromen-2-yl)-1,3-benzothiazol-2-yl]urea |
| SMILES | CCC(=O)CNC(=O)Nc1nc2ccc(-c3oc4c(OC)c(O)c(O)c(OC)c4c(=O)c3O)cc2s1 |
| InChI | InChI=1S/C23H21N3O9S/c1-4-10(27)8-24-22(32)26-23-25-11-6-5-9(7-12(11)36-23)18-15(29)14(28)13-19(33-2)16(30)17(31)21(34-3)20(13)35-18/h5-7,29-31H,4,8H2,1-3H3,(H2,24,25,26,32) |
| InChIKey | MRGBLPQQHOOJIK-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 180.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|