C19H24O4 — CID 171352579
(4aS,10aR,11aR,11bS)-4,4,8,11b-tetramethyl-4a,5,6,10a,11,11a-hexahydro-1H-[1]benzofuro[6,5-f]isochromene-2,9-dione (PubChem CID 171352579) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (4aS,10aR,11aR,11bS)-4,4,8,11b-tetramethyl-4a,5,6,10a,11,11a-hexahydro-1H-[1]benzofuro[6,5-f]isochromene-2,9-dione.
| Compound Name | (4aS,10aR,11aR,11bS)-4,4,8,11b-tetramethyl-4a,5,6,10a,11,11a-hexahydro-1H-[1]benzofuro[6,5-f]isochromene-2,9-dione |
|---|---|
| PubChem CID | 171352579 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (4aS,10aR,11aR,11bS)-4,4,8,11b-tetramethyl-4a,5,6,10a,11,11a-hexahydro-1H-[1]benzofuro[6,5-f]isochromene-2,9-dione |
| SMILES | CC1=C2C=C3CC[C@@H]4C(C)(C)OC(=O)C[C@@]4(C)[C@@H]3C[C@H]2OC1=O |
| InChI | InChI=1S/C19H24O4/c1-10-12-7-11-5-6-15-18(2,3)23-16(20)9-19(15,4)13(11)8-14(12)22-17(10)21/h7,13-15H,5-6,8-9H2,1-4H3/t13-,14-,15-,19+/m1/s1 |
| InChIKey | GUIRZKQLTCBGMC-GPINWOSQSA-N |
| XLogP | 3.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |