About 4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine
4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine (PubChem CID 171352731) has the molecular formula C15H10N2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine |
| PubChem CID | 171352731 |
| Molecular Formula | C15H10N2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine |
| SMILES | Nc1cc(C#CC#Cc2ccccc2)ccn1 |
| InChI | InChI=1S/C15H10N2/c16-15-12-14(10-11-17-15)9-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,10-12H,(H2,16,17) |
| InChIKey | DHUHGSJWMPKICB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine?
The IUPAC name of 4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine (CID 171352731) is 4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine.
What is the SMILES notation for 4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine?
The canonical SMILES for 4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine is Nc1cc(C#CC#Cc2ccccc2)ccn1.
What is the InChIKey of 4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine?
The InChIKey is DHUHGSJWMPKICB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2/c16-15-12-14(10-11-17-15)9-5-4-8-13-6-2-1-3-7-13/h1-3,6-7,10-12H,(H2,16,17).
What are the key properties of 4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine?
4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine has a molecular weight of 218.26 g/mol, XLogP of 2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-phenylbuta-1,3-diynyl)pyridin-2-amine is sourced from PubChem (CID 171352731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).