C11H12N4NaO5 — CID 171352742
CID 171352742 (PubChem CID 171352742) has the molecular formula C11H12N4NaO5 and a molecular weight of 303.23 g/mol.
| Compound Name | CID 171352742 |
|---|---|
| PubChem CID | 171352742 |
| Molecular Formula | C11H12N4NaO5 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | — |
| SMILES | CCOC(=O)c1nnc2c(C(=O)OCC)c[nH]n2c1=O.[Na] |
| InChI | InChI=1S/C11H12N4O5.Na/c1-3-19-10(17)6-5-12-15-8(6)14-13-7(9(15)16)11(18)20-4-2;/h5,12H,3-4H2,1-2H3; |
| InChIKey | WKYKDTJNUJKDQL-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 115.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |