C36H44N4O3 — CID 171352748
(1R,2R,4S,12R,13S,16Z)-25-(6-hydroxy-9H-pyrido[3,4-b]indol-1-yl)-28-oxa-11,22-diazahexacyclo[11.11.2.12,22.14,7.02,12.04,11]octacosa-16,25-dien-13-ol (PubChem CID 171352748) has the molecular formula C36H44N4O3 and a molecular weight of 580.77 g/mol. Its IUPAC name is (1R,2R,4S,12R,13S,16Z)-25-(6-hydroxy-9H-pyrido[3,4-b]indol-1-yl)-28-oxa-11,22-diazahexacyclo[11.11.2.12,22.14,7.02,12.04,11]octacosa-16,25-dien-13-ol.
| Compound Name | (1R,2R,4S,12R,13S,16Z)-25-(6-hydroxy-9H-pyrido[3,4-b]indol-1-yl)-28-oxa-11,22-diazahexacyclo[11.11.2.12,22.14,7.02,12.04,11]octacosa-16,25-dien-13-ol |
|---|---|
| PubChem CID | 171352748 |
| Molecular Formula | C36H44N4O3 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | (1R,2R,4S,12R,13S,16Z)-25-(6-hydroxy-9H-pyrido[3,4-b]indol-1-yl)-28-oxa-11,22-diazahexacyclo[11.11.2.12,22.14,7.02,12.04,11]octacosa-16,25-dien-13-ol |
| SMILES | Oc1ccc2[nH]c3c(C4=C[C@@]5(O)CC/C=C\CCCCN6CC[C@@H]4[C@@]4(C6)C[C@@]67CCC(CCCN6[C@H]45)O7)nccc3c2c1 |
| InChI | InChI=1S/C36H44N4O3/c41-24-9-10-30-27(20-24)26-12-16-37-31(32(26)38-30)28-21-35(42)14-5-3-1-2-4-6-17-39-19-13-29(28)34(23-39)22-36-15-11-25(43-36)8-7-18-40(36)33(34)35/h1,3,9-10,12,16,20-21,25,29,33,38,41-42H,2,4-8,11,13-15,17-19,22-23H2/b3-1-/t25?,29-,33+,34-,35-,36-/m0/s1 |
| InChIKey | YFLBQKLEXJGASL-ZMTPXVMSSA-N |
| XLogP | 6.12 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|