About 3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile
3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile (PubChem CID 171352777) has the molecular formula C21H20Cl2N4
and a molecular weight of 399.33 g/mol. Its IUPAC name is 3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile.
Molecular Properties
| Compound Name | 3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile |
| PubChem CID | 171352777 |
| Molecular Formula | C21H20Cl2N4 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(CN3CCN(Cc4ccc(Cl)cc4Cl)CC3)c2c1 |
| InChI | InChI=1S/C21H20Cl2N4/c22-18-3-2-16(20(23)10-18)13-26-5-7-27(8-6-26)14-17-12-25-21-4-1-15(11-24)9-19(17)21/h1-4,9-10,12,25H,5-8,13-14H2 |
| InChIKey | TYNNRTUHNRBHRF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile?
The IUPAC name of 3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile (CID 171352777) is 3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile.
What is the SMILES notation for 3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile?
The canonical SMILES for 3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile is N#Cc1ccc2[nH]cc(CN3CCN(Cc4ccc(Cl)cc4Cl)CC3)c2c1.
What is the InChIKey of 3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile?
The InChIKey is TYNNRTUHNRBHRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20Cl2N4/c22-18-3-2-16(20(23)10-18)13-26-5-7-27(8-6-26)14-17-12-25-21-4-1-15(11-24)9-19(17)21/h1-4,9-10,12,25H,5-8,13-14H2.
What are the key properties of 3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile?
3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile has a molecular weight of 399.33 g/mol, XLogP of 4.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[(2,4-dichlorophenyl)methyl]piperazin-1-yl]methyl]-1H-indole-5-carbonitrile is sourced from PubChem (CID 171352777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).