About 8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one
8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 171352815) has the molecular formula C8H15N3O3S
and a molecular weight of 233.29 g/mol. Its IUPAC name is 8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one.
Molecular Properties
| Compound Name | 8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one |
| PubChem CID | 171352815 |
| Molecular Formula | C8H15N3O3S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | CS(=O)(=O)N1CCC2(CC1)NCC(=O)N2 |
| InChI | InChI=1S/C8H15N3O3S/c1-15(13,14)11-4-2-8(3-5-11)9-6-7(12)10-8/h9H,2-6H2,1H3,(H,10,12) |
| InChIKey | DCIXOMUQOQJEHM-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one?
The IUPAC name of 8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one (CID 171352815) is 8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one.
What is the SMILES notation for 8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one?
The canonical SMILES for 8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one is CS(=O)(=O)N1CCC2(CC1)NCC(=O)N2.
What is the InChIKey of 8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one?
The InChIKey is DCIXOMUQOQJEHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O3S/c1-15(13,14)11-4-2-8(3-5-11)9-6-7(12)10-8/h9H,2-6H2,1H3,(H,10,12).
What are the key properties of 8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one?
8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one has a molecular weight of 233.29 g/mol, XLogP of -1.54, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methylsulfonyl-1,4,8-triazaspiro[4.5]decan-3-one is sourced from PubChem (CID 171352815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).