C25H31NO5 — CID 171352868
(2S,3S,4S)-2-[(1E,3E,5S,6R)-6-hydroxy-3,5-dimethylhepta-1,3-dienyl]-8-(4-hydroxyphenyl)-4-methoxy-3-methyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one (PubChem CID 171352868) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is (2S,3S,4S)-2-[(1E,3E,5S,6R)-6-hydroxy-3,5-dimethylhepta-1,3-dienyl]-8-(4-hydroxyphenyl)-4-methoxy-3-methyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one.
| Compound Name | (2S,3S,4S)-2-[(1E,3E,5S,6R)-6-hydroxy-3,5-dimethylhepta-1,3-dienyl]-8-(4-hydroxyphenyl)-4-methoxy-3-methyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one |
|---|---|
| PubChem CID | 171352868 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | (2S,3S,4S)-2-[(1E,3E,5S,6R)-6-hydroxy-3,5-dimethylhepta-1,3-dienyl]-8-(4-hydroxyphenyl)-4-methoxy-3-methyl-2,3,4,6-tetrahydropyrano[3,2-c]pyridin-5-one |
| SMILES | CO[C@@H]1c2c(c(-c3ccc(O)cc3)c[nH]c2=O)O[C@@H](/C=C/C(C)=C/[C@H](C)[C@@H](C)O)[C@@H]1C |
| InChI | InChI=1S/C25H31NO5/c1-14(12-15(2)17(4)27)6-11-21-16(3)23(30-5)22-24(31-21)20(13-26-25(22)29)18-7-9-19(28)10-8-18/h6-13,15-17,21,23,27-28H,1-5H3,(H,26,29)/b11-6+,14-12+/t15-,16-,17+,21-,23-/m0/s1 |
| InChIKey | YQGOVEGBDMSLSR-KMMNQZMOSA-N |
| XLogP | 4.35 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|