C25H30N2O9 — CID 171352984
tetraethyl 1',5'-dimethyl-2'-oxospiro[1H-pyrrole-5,3'-indole]-2,2,3,4-tetracarboxylate (PubChem CID 171352984) has the molecular formula C25H30N2O9 and a molecular weight of 502.52 g/mol. Its IUPAC name is tetraethyl 1',5'-dimethyl-2'-oxospiro[1H-pyrrole-5,3'-indole]-2,2,3,4-tetracarboxylate.
| Compound Name | tetraethyl 1',5'-dimethyl-2'-oxospiro[1H-pyrrole-5,3'-indole]-2,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 171352984 |
| Molecular Formula | C25H30N2O9 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | tetraethyl 1',5'-dimethyl-2'-oxospiro[1H-pyrrole-5,3'-indole]-2,2,3,4-tetracarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C2(NC1(C(=O)OCC)C(=O)OCC)C(=O)N(C)c1ccc(C)cc12 |
| InChI | InChI=1S/C25H30N2O9/c1-7-33-19(28)17-18(20(29)34-8-2)25(22(31)35-9-3,23(32)36-10-4)26-24(17)15-13-14(5)11-12-16(15)27(6)21(24)30/h11-13,26H,7-10H2,1-6H3 |
| InChIKey | LWKMENGKLAQUPV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|