C15H13Br2N5O2 — CID 171353130
2-[2,4-dibromo-3-(2,7-diaminopyrido[2,3-d]pyrimidin-6-yl)phenoxy]ethanol (PubChem CID 171353130) has the molecular formula C15H13Br2N5O2 and a molecular weight of 455.11 g/mol. Its IUPAC name is 2-[2,4-dibromo-3-(2,7-diaminopyrido[2,3-d]pyrimidin-6-yl)phenoxy]ethanol.
| Compound Name | 2-[2,4-dibromo-3-(2,7-diaminopyrido[2,3-d]pyrimidin-6-yl)phenoxy]ethanol |
|---|---|
| PubChem CID | 171353130 |
| Molecular Formula | C15H13Br2N5O2 |
| Molecular Weight | 455.11 g/mol |
| Exact Mass | 452.94 |
| IUPAC Name | 2-[2,4-dibromo-3-(2,7-diaminopyrido[2,3-d]pyrimidin-6-yl)phenoxy]ethanol |
| SMILES | Nc1ncc2cc(-c3c(Br)ccc(OCCO)c3Br)c(N)nc2n1 |
| InChI | InChI=1S/C15H13Br2N5O2/c16-9-1-2-10(24-4-3-23)12(17)11(9)8-5-7-6-20-15(19)22-14(7)21-13(8)18/h1-2,5-6,23H,3-4H2,(H4,18,19,20,21,22) |
| InChIKey | WAMXQVSTCMIXHE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.11 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |