C23H25F3N2O5 — CID 171353147
N-(4-benzoylphenyl)-7-[(3,3,3-trifluoro-2,2-dihydroxypropanoyl)amino]heptanamide (PubChem CID 171353147) has the molecular formula C23H25F3N2O5 and a molecular weight of 466.46 g/mol. Its IUPAC name is N-(4-benzoylphenyl)-7-[(3,3,3-trifluoro-2,2-dihydroxypropanoyl)amino]heptanamide.
| Compound Name | N-(4-benzoylphenyl)-7-[(3,3,3-trifluoro-2,2-dihydroxypropanoyl)amino]heptanamide |
|---|---|
| PubChem CID | 171353147 |
| Molecular Formula | C23H25F3N2O5 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N-(4-benzoylphenyl)-7-[(3,3,3-trifluoro-2,2-dihydroxypropanoyl)amino]heptanamide |
| SMILES | O=C(CCCCCCNC(=O)C(O)(O)C(F)(F)F)Nc1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25F3N2O5/c24-23(25,26)22(32,33)21(31)27-15-7-2-1-6-10-19(29)28-18-13-11-17(12-14-18)20(30)16-8-4-3-5-9-16/h3-5,8-9,11-14,32-33H,1-2,6-7,10,15H2,(H,27,31)(H,28,29) |
| InChIKey | FZPMUVGXDFQPHE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|