C22H27NO4 — CID 171353224
1-(1,2,3-trimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-8-yl)piperidine (PubChem CID 171353224) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 1-(1,2,3-trimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-8-yl)piperidine.
| Compound Name | 1-(1,2,3-trimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-8-yl)piperidine |
|---|---|
| PubChem CID | 171353224 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-(1,2,3-trimethoxy-5,6-dihydrobenzo[b][1]benzoxepin-8-yl)piperidine |
| SMILES | COc1cc2c(c(OC)c1OC)Oc1ccc(N3CCCCC3)cc1CC2 |
| InChI | InChI=1S/C22H27NO4/c1-24-19-14-16-8-7-15-13-17(23-11-5-4-6-12-23)9-10-18(15)27-20(16)22(26-3)21(19)25-2/h9-10,13-14H,4-8,11-12H2,1-3H3 |
| InChIKey | CEEXFROCRRSYBM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |