C27H28N6O3S — CID 171353227
1-[(3aR,7aR)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-2-[2-(benzenesulfonyl)anilino]ethanone (PubChem CID 171353227) has the molecular formula C27H28N6O3S and a molecular weight of 516.63 g/mol. Its IUPAC name is 1-[(3aR,7aR)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-2-[2-(benzenesulfonyl)anilino]ethanone.
| Compound Name | 1-[(3aR,7aR)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-2-[2-(benzenesulfonyl)anilino]ethanone |
|---|---|
| PubChem CID | 171353227 |
| Molecular Formula | C27H28N6O3S |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | 1-[(3aR,7aR)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-2-[2-(benzenesulfonyl)anilino]ethanone |
| SMILES | O=C(CNc1ccccc1S(=O)(=O)c1ccccc1)N1CC[C@H]2CCN(c3ncnc4[nH]ccc34)[C@H]2C1 |
| InChI | InChI=1S/C27H28N6O3S/c34-25(16-29-22-8-4-5-9-24(22)37(35,36)20-6-2-1-3-7-20)32-14-11-19-12-15-33(23(19)17-32)27-21-10-13-28-26(21)30-18-31-27/h1-10,13,18-19,23,29H,11-12,14-17H2,(H,28,30,31)/t19-,23-/m0/s1 |
| InChIKey | RCYZLPTXMFAJEQ-CVDCTZTESA-N |
| XLogP | 3.33 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |