C21H22N4O6 — CID 171353244
ethyl (1E)-N-[6-cyano-5-(2,3-dimethoxyphenyl)-1,3-dimethyl-2,4-dioxo-5H-pyrano[2,3-d]pyrimidin-7-yl]methanimidate (PubChem CID 171353244) has the molecular formula C21H22N4O6 and a molecular weight of 426.43 g/mol. Its IUPAC name is ethyl (1E)-N-[6-cyano-5-(2,3-dimethoxyphenyl)-1,3-dimethyl-2,4-dioxo-5H-pyrano[2,3-d]pyrimidin-7-yl]methanimidate.
| Compound Name | ethyl (1E)-N-[6-cyano-5-(2,3-dimethoxyphenyl)-1,3-dimethyl-2,4-dioxo-5H-pyrano[2,3-d]pyrimidin-7-yl]methanimidate |
|---|---|
| PubChem CID | 171353244 |
| Molecular Formula | C21H22N4O6 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | ethyl (1E)-N-[6-cyano-5-(2,3-dimethoxyphenyl)-1,3-dimethyl-2,4-dioxo-5H-pyrano[2,3-d]pyrimidin-7-yl]methanimidate |
| SMILES | CCO/C=N/C1=C(C#N)C(c2cccc(OC)c2OC)c2c(n(C)c(=O)n(C)c2=O)O1 |
| InChI | InChI=1S/C21H22N4O6/c1-6-30-11-23-18-13(10-22)15(12-8-7-9-14(28-4)17(12)29-5)16-19(26)24(2)21(27)25(3)20(16)31-18/h7-9,11,15H,6H2,1-5H3/b23-11+ |
| InChIKey | UWLOTMRNBWUDKO-FOKLQQMPSA-N |
| XLogP | 1.43 |
| TPSA | 117.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|