About 4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine
4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine (PubChem CID 171353446) has the molecular formula C23H17Cl2N3O
and a molecular weight of 422.32 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine |
| PubChem CID | 171353446 |
| Molecular Formula | C23H17Cl2N3O |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine |
| SMILES | Nc1nc(-c2cccc(OCc3ccccc3)c2)cc(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C23H17Cl2N3O/c24-17-9-10-19(20(25)12-17)22-13-21(27-23(26)28-22)16-7-4-8-18(11-16)29-14-15-5-2-1-3-6-15/h1-13H,14H2,(H2,26,27,28) |
| InChIKey | BFAJAWNTZHFNRO-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine?
The IUPAC name of 4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine (CID 171353446) is 4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine.
What is the SMILES notation for 4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine?
The canonical SMILES for 4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine is Nc1nc(-c2cccc(OCc3ccccc3)c2)cc(-c2ccc(Cl)cc2Cl)n1.
What is the InChIKey of 4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine?
The InChIKey is BFAJAWNTZHFNRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17Cl2N3O/c24-17-9-10-19(20(25)12-17)22-13-21(27-23(26)28-22)16-7-4-8-18(11-16)29-14-15-5-2-1-3-6-15/h1-13H,14H2,(H2,26,27,28).
What are the key properties of 4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine?
4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine has a molecular weight of 422.32 g/mol, XLogP of 6.28, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorophenyl)-6-(3-phenylmethoxyphenyl)pyrimidin-2-amine is sourced from PubChem (CID 171353446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).