C33H34N4O3 — CID 171353499
(6S)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-(naphthalen-1-ylmethyl)-4-oxo-2,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrimidine-1-carboxamide (PubChem CID 171353499) has the molecular formula C33H34N4O3 and a molecular weight of 534.66 g/mol. Its IUPAC name is (6S)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-(naphthalen-1-ylmethyl)-4-oxo-2,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrimidine-1-carboxamide.
| Compound Name | (6S)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-(naphthalen-1-ylmethyl)-4-oxo-2,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 171353499 |
| Molecular Formula | C33H34N4O3 |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | (6S)-N-benzyl-6-[(4-hydroxyphenyl)methyl]-8-(naphthalen-1-ylmethyl)-4-oxo-2,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrimidine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCC(=O)N2C1CN(Cc1cccc3ccccc13)C[C@@H]2Cc1ccc(O)cc1 |
| InChI | InChI=1S/C33H34N4O3/c38-29-15-13-24(14-16-29)19-28-22-35(21-27-11-6-10-26-9-4-5-12-30(26)27)23-31-36(18-17-32(39)37(28)31)33(40)34-20-25-7-2-1-3-8-25/h1-16,28,31,38H,17-23H2,(H,34,40)/t28-,31?/m0/s1 |
| InChIKey | KDRPMFHUQNHYGE-NPHAVVRNSA-N |
| XLogP | 4.74 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |