C25H27N3O5S — CID 171353585
3-[4-[[5-[2-(tert-butylsulfamoyl)phenyl]pyridine-3-carbonyl]amino]phenyl]propanoic acid (PubChem CID 171353585) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is 3-[4-[[5-[2-(tert-butylsulfamoyl)phenyl]pyridine-3-carbonyl]amino]phenyl]propanoic acid.
| Compound Name | 3-[4-[[5-[2-(tert-butylsulfamoyl)phenyl]pyridine-3-carbonyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 171353585 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 3-[4-[[5-[2-(tert-butylsulfamoyl)phenyl]pyridine-3-carbonyl]amino]phenyl]propanoic acid |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccccc1-c1cncc(C(=O)Nc2ccc(CCC(=O)O)cc2)c1 |
| InChI | InChI=1S/C25H27N3O5S/c1-25(2,3)28-34(32,33)22-7-5-4-6-21(22)18-14-19(16-26-15-18)24(31)27-20-11-8-17(9-12-20)10-13-23(29)30/h4-9,11-12,14-16,28H,10,13H2,1-3H3,(H,27,31)(H,29,30) |
| InChIKey | YQCJNWJIDSUBCQ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |