C27H36O6 — CID 171353752
5-[3-[(1R,4S,5S,6E,9R,10E,12R)-5,9,14,14-tetramethyl-2-oxo-3,13,15-trioxabicyclo[10.3.0]pentadeca-6,10-dien-4-yl]phenyl]pentanoic acid (PubChem CID 171353752) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is 5-[3-[(1R,4S,5S,6E,9R,10E,12R)-5,9,14,14-tetramethyl-2-oxo-3,13,15-trioxabicyclo[10.3.0]pentadeca-6,10-dien-4-yl]phenyl]pentanoic acid.
| Compound Name | 5-[3-[(1R,4S,5S,6E,9R,10E,12R)-5,9,14,14-tetramethyl-2-oxo-3,13,15-trioxabicyclo[10.3.0]pentadeca-6,10-dien-4-yl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 171353752 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 5-[3-[(1R,4S,5S,6E,9R,10E,12R)-5,9,14,14-tetramethyl-2-oxo-3,13,15-trioxabicyclo[10.3.0]pentadeca-6,10-dien-4-yl]phenyl]pentanoic acid |
| SMILES | C[C@H]1/C=C/[C@H]2OC(C)(C)O[C@H]2C(=O)O[C@H](c2cccc(CCCCC(=O)O)c2)[C@@H](C)/C=C/C1 |
| InChI | InChI=1S/C27H36O6/c1-18-9-7-10-19(2)24(21-13-8-12-20(17-21)11-5-6-14-23(28)29)31-26(30)25-22(16-15-18)32-27(3,4)33-25/h7-8,10,12-13,15-19,22,24-25H,5-6,9,11,14H2,1-4H3,(H,28,29)/b10-7+,16-15+/t18-,19+,22-,24+,25-/m1/s1 |
| InChIKey | YUZKYRDMFBZDGH-VJUYHVHESA-N |
| XLogP | 5.38 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|