C14H19N7O — CID 171353921
2,4,5,8,15,17,20-heptazatricyclo[14.3.1.13,6]henicosa-1(20),3,6(21),16,18-pentaen-7-one (PubChem CID 171353921) has the molecular formula C14H19N7O and a molecular weight of 301.35 g/mol. Its IUPAC name is 2,4,5,8,15,17,20-heptazatricyclo[14.3.1.13,6]henicosa-1(20),3,6(21),16,18-pentaen-7-one.
| Compound Name | 2,4,5,8,15,17,20-heptazatricyclo[14.3.1.13,6]henicosa-1(20),3,6(21),16,18-pentaen-7-one |
|---|---|
| PubChem CID | 171353921 |
| Molecular Formula | C14H19N7O |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 2,4,5,8,15,17,20-heptazatricyclo[14.3.1.13,6]henicosa-1(20),3,6(21),16,18-pentaen-7-one |
| SMILES | O=C1NCCCCCCNc2nccc(n2)Nc2cc1[nH]n2 |
| InChI | InChI=1S/C14H19N7O/c22-13-10-9-12(21-20-10)18-11-5-8-17-14(19-11)16-7-4-2-1-3-6-15-13/h5,8-9H,1-4,6-7H2,(H,15,22)(H3,16,17,18,19,20,21) |
| InChIKey | RWJGAHJEMNZHTE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |