C8H14FNO4 — CID 171353934
(1R,2R,3R,6S,7R,8S)-6-fluoro-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol (PubChem CID 171353934) has the molecular formula C8H14FNO4 and a molecular weight of 207.20 g/mol. Its IUPAC name is (1R,2R,3R,6S,7R,8S)-6-fluoro-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol.
| Compound Name | (1R,2R,3R,6S,7R,8S)-6-fluoro-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol |
|---|---|
| PubChem CID | 171353934 |
| Molecular Formula | C8H14FNO4 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (1R,2R,3R,6S,7R,8S)-6-fluoro-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2,7-triol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@H]2[C@@H](O)[C@@H](F)CN21 |
| InChI | InChI=1S/C8H14FNO4/c9-3-1-10-4(2-11)7(13)8(14)5(10)6(3)12/h3-8,11-14H,1-2H2/t3-,4+,5+,6-,7+,8+/m0/s1 |
| InChIKey | HVKNJBFAJLQLGG-JMHNFOGYSA-N |
| XLogP | -2.53 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |