C16H21Cl2NO6S2 — CID 171353945
6-[[(3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-yl]amino]hexanoic acid (PubChem CID 171353945) has the molecular formula C16H21Cl2NO6S2 and a molecular weight of 458.39 g/mol. Its IUPAC name is 6-[[(3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-yl]amino]hexanoic acid.
| Compound Name | 6-[[(3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-yl]amino]hexanoic acid |
|---|---|
| PubChem CID | 171353945 |
| Molecular Formula | C16H21Cl2NO6S2 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | 6-[[(3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-yl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H21Cl2NO6S2/c17-12-6-5-11(8-13(12)18)27(24,25)15-10-26(22,23)9-14(15)19-7-3-1-2-4-16(20)21/h5-6,8,14-15,19H,1-4,7,9-10H2,(H,20,21)/t14-,15-/m0/s1 |
| InChIKey | SMRUDFQSOICZHS-GJZGRUSLSA-N |
| XLogP | 2.17 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|