C22H22N6OS — CID 171354027
N'-[5-[2-(4-tert-butylphenyl)-4-methyl-1,3-thiazol-5-yl]-1,3,4-oxadiazol-2-yl]pyridine-3-carboximidamide (PubChem CID 171354027) has the molecular formula C22H22N6OS and a molecular weight of 418.53 g/mol. Its IUPAC name is N'-[5-[2-(4-tert-butylphenyl)-4-methyl-1,3-thiazol-5-yl]-1,3,4-oxadiazol-2-yl]pyridine-3-carboximidamide.
| Compound Name | N'-[5-[2-(4-tert-butylphenyl)-4-methyl-1,3-thiazol-5-yl]-1,3,4-oxadiazol-2-yl]pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 171354027 |
| Molecular Formula | C22H22N6OS |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N'-[5-[2-(4-tert-butylphenyl)-4-methyl-1,3-thiazol-5-yl]-1,3,4-oxadiazol-2-yl]pyridine-3-carboximidamide |
| SMILES | Cc1nc(-c2ccc(C(C)(C)C)cc2)sc1-c1nnc(/N=C(\N)c2cccnc2)o1 |
| InChI | InChI=1S/C22H22N6OS/c1-13-17(30-20(25-13)14-7-9-16(10-8-14)22(2,3)4)19-27-28-21(29-19)26-18(23)15-6-5-11-24-12-15/h5-12H,1-4H3,(H2,23,26,28) |
| InChIKey | HPJBMBPYPAAMMM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 103.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|