C24H20ClN3O3 — CID 171354090
pyridin-3-yl 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 171354090) has the molecular formula C24H20ClN3O3 and a molecular weight of 433.90 g/mol. Its IUPAC name is pyridin-3-yl 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | pyridin-3-yl 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 171354090 |
| Molecular Formula | C24H20ClN3O3 |
| Molecular Weight | 433.90 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | pyridin-3-yl 6-chloro-1-(4-methoxyphenyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | COc1ccc(C2c3[nH]c4ccc(Cl)cc4c3CCN2C(=O)Oc2cccnc2)cc1 |
| InChI | InChI=1S/C24H20ClN3O3/c1-30-17-7-4-15(5-8-17)23-22-19(20-13-16(25)6-9-21(20)27-22)10-12-28(23)24(29)31-18-3-2-11-26-14-18/h2-9,11,13-14,23,27H,10,12H2,1H3 |
| InChIKey | YDTCFSFEVWSGCZ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.90 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|