C40H74O5 — CID 171354234
(2E,6E,10E)-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,30-tetraene-1,15,19,23,27-pentol (PubChem CID 171354234) has the molecular formula C40H74O5 and a molecular weight of 635.03 g/mol. Its IUPAC name is (2E,6E,10E)-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,30-tetraene-1,15,19,23,27-pentol.
| Compound Name | (2E,6E,10E)-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,30-tetraene-1,15,19,23,27-pentol |
|---|---|
| PubChem CID | 171354234 |
| Molecular Formula | C40H74O5 |
| Molecular Weight | 635.03 g/mol |
| Exact Mass | 634.55 |
| IUPAC Name | (2E,6E,10E)-3,7,11,15,19,23,27,31-octamethyldotriaconta-2,6,10,30-tetraene-1,15,19,23,27-pentol |
| SMILES | CC(C)=CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCCC(C)(O)CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C40H74O5/c1-33(2)17-12-24-37(6,42)26-14-28-39(8,44)30-16-31-40(9,45)29-15-27-38(7,43)25-13-22-35(4)20-10-18-34(3)19-11-21-36(5)23-32-41/h17,19-20,23,41-45H,10-16,18,21-22,24-32H2,1-9H3/b34-19+,35-20+,36-23+ |
| InChIKey | NRHQGMHZGRLBGG-HDBHYADGSA-N |
| XLogP | 9.81 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.03 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|