C27H38O6 — CID 171354267
[(E)-2-[(1S,2S,7S)-5-(acetyloxymethyl)-2-methyl-2-(4-methylpent-3-enyl)-6-oxo-7-(2-oxopropyl)cyclohept-4-en-1-yl]ethenyl] 3-methylbut-2-enoate (PubChem CID 171354267) has the molecular formula C27H38O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is [(E)-2-[(1S,2S,7S)-5-(acetyloxymethyl)-2-methyl-2-(4-methylpent-3-enyl)-6-oxo-7-(2-oxopropyl)cyclohept-4-en-1-yl]ethenyl] 3-methylbut-2-enoate.
| Compound Name | [(E)-2-[(1S,2S,7S)-5-(acetyloxymethyl)-2-methyl-2-(4-methylpent-3-enyl)-6-oxo-7-(2-oxopropyl)cyclohept-4-en-1-yl]ethenyl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 171354267 |
| Molecular Formula | C27H38O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | [(E)-2-[(1S,2S,7S)-5-(acetyloxymethyl)-2-methyl-2-(4-methylpent-3-enyl)-6-oxo-7-(2-oxopropyl)cyclohept-4-en-1-yl]ethenyl] 3-methylbut-2-enoate |
| SMILES | CC(=O)C[C@@H]1C(=O)C(COC(C)=O)=CC[C@](C)(CCC=C(C)C)[C@H]1/C=C/OC(=O)C=C(C)C |
| InChI | InChI=1S/C27H38O6/c1-18(2)9-8-12-27(7)13-10-22(17-33-21(6)29)26(31)23(16-20(5)28)24(27)11-14-32-25(30)15-19(3)4/h9-11,14-15,23-24H,8,12-13,16-17H2,1-7H3/b14-11+/t23-,24-,27-/m0/s1 |
| InChIKey | LLTWFBSPUXJQTN-KXIPVDOFSA-N |
| XLogP | 5.44 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|