C31H46O3 — CID 171354269
(1S,5R,7R)-5-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione (PubChem CID 171354269) has the molecular formula C31H46O3 and a molecular weight of 466.71 g/mol. Its IUPAC name is (1S,5R,7R)-5-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione.
| Compound Name | (1S,5R,7R)-5-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
|---|---|
| PubChem CID | 171354269 |
| Molecular Formula | C31H46O3 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | (1S,5R,7R)-5-[(2E)-3,7-dimethylocta-2,6-dienyl]-6,6-dimethyl-1,7-bis(3-methylbut-2-enyl)bicyclo[3.3.1]nonane-2,4,9-trione |
| SMILES | CC(C)=CCC/C(C)=C/C[C@]12C(=O)CC(=O)[C@](CC=C(C)C)(C[C@@H](CC=C(C)C)C1(C)C)C2=O |
| InChI | InChI=1S/C31H46O3/c1-21(2)11-10-12-24(7)16-18-31-27(33)19-26(32)30(28(31)34,17-15-23(5)6)20-25(29(31,8)9)14-13-22(3)4/h11,13,15-16,25H,10,12,14,17-20H2,1-9H3/b24-16+/t25-,30+,31-/m1/s1 |
| InChIKey | QCHIVSZSANBXDS-OZTAVCCBSA-N |
| XLogP | 7.91 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|