C14H11N5O3 — CID 171354350
6-methyl-8-pyridin-4-yl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione (PubChem CID 171354350) has the molecular formula C14H11N5O3 and a molecular weight of 297.27 g/mol. Its IUPAC name is 6-methyl-8-pyridin-4-yl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione.
| Compound Name | 6-methyl-8-pyridin-4-yl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione |
|---|---|
| PubChem CID | 171354350 |
| Molecular Formula | C14H11N5O3 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 6-methyl-8-pyridin-4-yl-2-oxa-4,5,11,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,6-triene-10,12-dione |
| SMILES | Cc1[nH]nc2c1C(c1ccncc1)c1c([nH]c(=O)[nH]c1=O)O2 |
| InChI | InChI=1S/C14H11N5O3/c1-6-8-9(7-2-4-15-5-3-7)10-11(20)16-14(21)17-12(10)22-13(8)19-18-6/h2-5,9H,1H3,(H,18,19)(H2,16,17,20,21) |
| InChIKey | MNRGPMBQYNUPOZ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 116.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |