About [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride
[4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride (PubChem CID 171354375) has the molecular formula C21H23ClN2O2
and a molecular weight of 370.88 g/mol. Its IUPAC name is [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride.
Molecular Properties
| Compound Name | [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride |
| PubChem CID | 171354375 |
| Molecular Formula | C21H23ClN2O2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride |
| SMILES | Cc1cccc([C@H](C)c2cn(COC(=O)c3ccccc3)cn2)c1C.Cl |
| InChI | InChI=1S/C21H22N2O2.ClH/c1-15-8-7-11-19(16(15)2)17(3)20-12-23(13-22-20)14-25-21(24)18-9-5-4-6-10-18;/h4-13,17H,14H2,1-3H3;1H/t17-;/m0./s1 |
| InChIKey | HJJIDUAFAMGQTN-LMOVPXPDSA-N |
| XLogP | 4.89 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride?
The IUPAC name of [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride (CID 171354375) is [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride.
What is the SMILES notation for [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride?
The canonical SMILES for [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride is Cc1cccc([C@H](C)c2cn(COC(=O)c3ccccc3)cn2)c1C.Cl.
What is the InChIKey of [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride?
The InChIKey is HJJIDUAFAMGQTN-LMOVPXPDSA-N. The full InChI is InChI=1S/C21H22N2O2.ClH/c1-15-8-7-11-19(16(15)2)17(3)20-12-23(13-22-20)14-25-21(24)18-9-5-4-6-10-18;/h4-13,17H,14H2,1-3H3;1H/t17-;/m0./s1.
What are the key properties of [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride?
[4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride has a molecular weight of 370.88 g/mol, XLogP of 4.89, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(1S)-1-(2,3-dimethylphenyl)ethyl]imidazol-1-yl]methyl benzoate;hydrochloride is sourced from PubChem (CID 171354375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).