C32H36N2O2 — CID 171354516
(2S,3R,4R,5S)-2,5-bis(benzylamino)-1,6-diphenylhexane-3,4-diol (PubChem CID 171354516) has the molecular formula C32H36N2O2 and a molecular weight of 480.65 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2,5-bis(benzylamino)-1,6-diphenylhexane-3,4-diol.
| Compound Name | (2S,3R,4R,5S)-2,5-bis(benzylamino)-1,6-diphenylhexane-3,4-diol |
|---|---|
| PubChem CID | 171354516 |
| Molecular Formula | C32H36N2O2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | (2S,3R,4R,5S)-2,5-bis(benzylamino)-1,6-diphenylhexane-3,4-diol |
| SMILES | O[C@@H]([C@H](O)[C@H](Cc1ccccc1)NCc1ccccc1)[C@H](Cc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C32H36N2O2/c35-31(29(21-25-13-5-1-6-14-25)33-23-27-17-9-3-10-18-27)32(36)30(22-26-15-7-2-8-16-26)34-24-28-19-11-4-12-20-28/h1-20,29-36H,21-24H2/t29-,30-,31+,32+/m0/s1 |
| InChIKey | XMFWOSZPCRXJEP-GASGPIRDSA-N |
| XLogP | 4.51 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |