C16H24Cl2N2O4S2 — CID 171354601
N'-[(3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-yl]hexane-1,6-diamine (PubChem CID 171354601) has the molecular formula C16H24Cl2N2O4S2 and a molecular weight of 443.42 g/mol. Its IUPAC name is N'-[(3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-yl]hexane-1,6-diamine.
| Compound Name | N'-[(3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-yl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 171354601 |
| Molecular Formula | C16H24Cl2N2O4S2 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | N'-[(3S,4R)-4-(3,4-dichlorophenyl)sulfonyl-1,1-dioxothiolan-3-yl]hexane-1,6-diamine |
| SMILES | NCCCCCCN[C@H]1CS(=O)(=O)C[C@@H]1S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H24Cl2N2O4S2/c17-13-6-5-12(9-14(13)18)26(23,24)16-11-25(21,22)10-15(16)20-8-4-2-1-3-7-19/h5-6,9,15-16,20H,1-4,7-8,10-11,19H2/t15-,16-/m0/s1 |
| InChIKey | IIOZKTHYLGXAIC-HOTGVXAUSA-N |
| XLogP | 2.04 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|