C28H36N2O — CID 171354607
4-[[(8R,9S,13S,14S,17S)-13-methyl-17-pyrrolidin-1-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxymethyl]pyridine (PubChem CID 171354607) has the molecular formula C28H36N2O and a molecular weight of 416.61 g/mol. Its IUPAC name is 4-[[(8R,9S,13S,14S,17S)-13-methyl-17-pyrrolidin-1-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxymethyl]pyridine.
| Compound Name | 4-[[(8R,9S,13S,14S,17S)-13-methyl-17-pyrrolidin-1-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxymethyl]pyridine |
|---|---|
| PubChem CID | 171354607 |
| Molecular Formula | C28H36N2O |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | 4-[[(8R,9S,13S,14S,17S)-13-methyl-17-pyrrolidin-1-yl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]oxymethyl]pyridine |
| SMILES | C[C@]12CC[C@@H]3c4ccc(OCc5ccncc5)cc4CC[C@H]3[C@@H]1CC[C@@H]2N1CCCC1 |
| InChI | InChI=1S/C28H36N2O/c1-28-13-10-24-23-7-5-22(31-19-20-11-14-29-15-12-20)18-21(23)4-6-25(24)26(28)8-9-27(28)30-16-2-3-17-30/h5,7,11-12,14-15,18,24-27H,2-4,6,8-10,13,16-17,19H2,1H3/t24-,25-,26+,27+,28+/m1/s1 |
| InChIKey | FZCOANZFSQVZEL-MASCHLQQSA-N |
| XLogP | 5.98 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |