C29H41NO5 — CID 171354636
4-[4-(2-methylpropanoyl)-1-[3-(4-octylphenoxy)-2-oxopropyl]pyrrol-3-yl]butanoic acid (PubChem CID 171354636) has the molecular formula C29H41NO5 and a molecular weight of 483.65 g/mol. Its IUPAC name is 4-[4-(2-methylpropanoyl)-1-[3-(4-octylphenoxy)-2-oxopropyl]pyrrol-3-yl]butanoic acid.
| Compound Name | 4-[4-(2-methylpropanoyl)-1-[3-(4-octylphenoxy)-2-oxopropyl]pyrrol-3-yl]butanoic acid |
|---|---|
| PubChem CID | 171354636 |
| Molecular Formula | C29H41NO5 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | 4-[4-(2-methylpropanoyl)-1-[3-(4-octylphenoxy)-2-oxopropyl]pyrrol-3-yl]butanoic acid |
| SMILES | CCCCCCCCc1ccc(OCC(=O)Cn2cc(CCCC(=O)O)c(C(=O)C(C)C)c2)cc1 |
| InChI | InChI=1S/C29H41NO5/c1-4-5-6-7-8-9-11-23-14-16-26(17-15-23)35-21-25(31)19-30-18-24(12-10-13-28(32)33)27(20-30)29(34)22(2)3/h14-18,20,22H,4-13,19,21H2,1-3H3,(H,32,33) |
| InChIKey | KRBWLWJAQJPVLK-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|