C29H31NO8 — CID 171354906
N-[[(2S,3S)-6-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-3-(4-hydroxy-3,5-dimethoxyphenyl)-2,3-dihydro-1,4-benzodioxin-2-yl]methyl]-2-methylpropanamide (PubChem CID 171354906) has the molecular formula C29H31NO8 and a molecular weight of 521.57 g/mol. Its IUPAC name is N-[[(2S,3S)-6-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-3-(4-hydroxy-3,5-dimethoxyphenyl)-2,3-dihydro-1,4-benzodioxin-2-yl]methyl]-2-methylpropanamide.
| Compound Name | N-[[(2S,3S)-6-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-3-(4-hydroxy-3,5-dimethoxyphenyl)-2,3-dihydro-1,4-benzodioxin-2-yl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 171354906 |
| Molecular Formula | C29H31NO8 |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | N-[[(2S,3S)-6-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-3-(4-hydroxy-3,5-dimethoxyphenyl)-2,3-dihydro-1,4-benzodioxin-2-yl]methyl]-2-methylpropanamide |
| SMILES | COc1cc([C@@H]2Oc3cc(/C=C/c4cc(O)cc(O)c4)ccc3O[C@H]2CNC(=O)C(C)C)cc(OC)c1O |
| InChI | InChI=1S/C29H31NO8/c1-16(2)29(34)30-15-26-28(19-12-24(35-3)27(33)25(13-19)36-4)38-23-11-17(7-8-22(23)37-26)5-6-18-9-20(31)14-21(32)10-18/h5-14,16,26,28,31-33H,15H2,1-4H3,(H,30,34)/b6-5+/t26-,28-/m0/s1 |
| InChIKey | MWWPSNLYKUHUEN-FCUWUQBFSA-N |
| XLogP | 4.64 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|