C16H20N2O2 — CID 171355020
(3Z,6S)-3-benzylidene-6-(3-methylbutyl)piperazine-2,5-dione (PubChem CID 171355020) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is (3Z,6S)-3-benzylidene-6-(3-methylbutyl)piperazine-2,5-dione.
| Compound Name | (3Z,6S)-3-benzylidene-6-(3-methylbutyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 171355020 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (3Z,6S)-3-benzylidene-6-(3-methylbutyl)piperazine-2,5-dione |
| SMILES | CC(C)CC[C@@H]1NC(=O)/C(=C/c2ccccc2)NC1=O |
| InChI | InChI=1S/C16H20N2O2/c1-11(2)8-9-13-15(19)18-14(16(20)17-13)10-12-6-4-3-5-7-12/h3-7,10-11,13H,8-9H2,1-2H3,(H,17,20)(H,18,19)/b14-10-/t13-/m0/s1 |
| InChIKey | JFRIPCBXGJWVLS-ODUNQGDFSA-N |
| XLogP | 2.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|