C20H22O6 — CID 171355294
methyl 6-ethyl-3-methoxy-1,1,7-trimethyl-4,9-dioxobenzo[f][2]benzofuran-3-carboxylate (PubChem CID 171355294) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is methyl 6-ethyl-3-methoxy-1,1,7-trimethyl-4,9-dioxobenzo[f][2]benzofuran-3-carboxylate.
| Compound Name | methyl 6-ethyl-3-methoxy-1,1,7-trimethyl-4,9-dioxobenzo[f][2]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 171355294 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | methyl 6-ethyl-3-methoxy-1,1,7-trimethyl-4,9-dioxobenzo[f][2]benzofuran-3-carboxylate |
| SMILES | CCc1cc2c(cc1C)C(=O)C1=C(C2=O)C(OC)(C(=O)OC)OC1(C)C |
| InChI | InChI=1S/C20H22O6/c1-7-11-9-13-12(8-10(11)2)16(21)14-15(17(13)22)20(25-6,18(23)24-5)26-19(14,3)4/h8-9H,7H2,1-6H3 |
| InChIKey | UJSHKOCJCAJWEW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|