C8H14FNO3 — CID 171355341
(1R,2R,3R,6R,8R)-6-fluoro-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol (PubChem CID 171355341) has the molecular formula C8H14FNO3 and a molecular weight of 191.20 g/mol. Its IUPAC name is (1R,2R,3R,6R,8R)-6-fluoro-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol.
| Compound Name | (1R,2R,3R,6R,8R)-6-fluoro-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
|---|---|
| PubChem CID | 171355341 |
| Molecular Formula | C8H14FNO3 |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | (1R,2R,3R,6R,8R)-6-fluoro-3-(hydroxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine-1,2-diol |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)[C@H]2C[C@@H](F)CN12 |
| InChI | InChI=1S/C8H14FNO3/c9-4-1-5-7(12)8(13)6(3-11)10(5)2-4/h4-8,11-13H,1-3H2/t4-,5-,6-,7-,8-/m1/s1 |
| InChIKey | BFECHUAZUACWEL-FMDGEEDCSA-N |
| XLogP | -1.50 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |