About [2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate
[2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate (PubChem CID 171355416) has the molecular formula C21H25NO3
and a molecular weight of 339.44 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate.
Molecular Properties
| Compound Name | [2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate |
| PubChem CID | 171355416 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | [2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate |
| SMILES | Cc1cccc(C)c1C(=O)OC(C(=O)NC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H25NO3/c1-14-10-9-11-15(2)17(14)20(24)25-18(16-12-7-6-8-13-16)19(23)22-21(3,4)5/h6-13,18H,1-5H3,(H,22,23) |
| InChIKey | YEXPOLYJSYLWKQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate?
The IUPAC name of [2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate (CID 171355416) is [2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate.
What is the SMILES notation for [2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate?
The canonical SMILES for [2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate is Cc1cccc(C)c1C(=O)OC(C(=O)NC(C)(C)C)c1ccccc1.
What is the InChIKey of [2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate?
The InChIKey is YEXPOLYJSYLWKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO3/c1-14-10-9-11-15(2)17(14)20(24)25-18(16-12-7-6-8-13-16)19(23)22-21(3,4)5/h6-13,18H,1-5H3,(H,22,23).
What are the key properties of [2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate?
[2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate has a molecular weight of 339.44 g/mol, XLogP of 4.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(tert-butylamino)-2-oxo-1-phenylethyl] 2,6-dimethylbenzoate is sourced from PubChem (CID 171355416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).