C24H22ClNO6 — CID 171355474
(7R)-2-chloro-3-(3-methoxypropoxy)-11-oxo-7-phenyl-6,7-dihydropyrido[1,2-d][1,4]benzoxazepine-10-carboxylic acid (PubChem CID 171355474) has the molecular formula C24H22ClNO6 and a molecular weight of 455.89 g/mol. Its IUPAC name is (7R)-2-chloro-3-(3-methoxypropoxy)-11-oxo-7-phenyl-6,7-dihydropyrido[1,2-d][1,4]benzoxazepine-10-carboxylic acid.
| Compound Name | (7R)-2-chloro-3-(3-methoxypropoxy)-11-oxo-7-phenyl-6,7-dihydropyrido[1,2-d][1,4]benzoxazepine-10-carboxylic acid |
|---|---|
| PubChem CID | 171355474 |
| Molecular Formula | C24H22ClNO6 |
| Molecular Weight | 455.89 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | (7R)-2-chloro-3-(3-methoxypropoxy)-11-oxo-7-phenyl-6,7-dihydropyrido[1,2-d][1,4]benzoxazepine-10-carboxylic acid |
| SMILES | COCCCOc1cc2c(cc1Cl)-c1cc(=O)c(C(=O)O)cn1[C@H](c1ccccc1)CO2 |
| InChI | InChI=1S/C24H22ClNO6/c1-30-8-5-9-31-23-12-22-16(10-18(23)25)19-11-21(27)17(24(28)29)13-26(19)20(14-32-22)15-6-3-2-4-7-15/h2-4,6-7,10-13,20H,5,8-9,14H2,1H3,(H,28,29)/t20-/m0/s1 |
| InChIKey | HUSKLZOLWRWWBA-FQEVSTJZSA-N |
| XLogP | 4.26 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.89 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|