C26H36O4 — CID 171355544
(1R,5R,7R)-4-hydroxy-8,8-dimethyl-7-(3-methylbut-2-enyl)-3-(2-methylpropanoyl)-1,5-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 171355544) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is (1R,5R,7R)-4-hydroxy-8,8-dimethyl-7-(3-methylbut-2-enyl)-3-(2-methylpropanoyl)-1,5-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (1R,5R,7R)-4-hydroxy-8,8-dimethyl-7-(3-methylbut-2-enyl)-3-(2-methylpropanoyl)-1,5-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 171355544 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | (1R,5R,7R)-4-hydroxy-8,8-dimethyl-7-(3-methylbut-2-enyl)-3-(2-methylpropanoyl)-1,5-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | C=CC[C@@]12C[C@@H](CC=C(C)C)C(C)(C)[C@@](CC=C)(C(=O)C(C(=O)C(C)C)=C1O)C2=O |
| InChI | InChI=1S/C26H36O4/c1-9-13-25-15-18(12-11-16(3)4)24(7,8)26(14-10-2,23(25)30)22(29)19(21(25)28)20(27)17(5)6/h9-11,17-18,28H,1-2,12-15H2,3-8H3/t18-,25-,26+/m1/s1 |
| InChIKey | DBGHFWYOUHBTHH-IHMJZKOGSA-N |
| XLogP | 5.70 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|