C20H21N3O3 — CID 171355591
5-[3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1H-pyrazol-5-yl]-1H-indole (PubChem CID 171355591) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 5-[3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1H-pyrazol-5-yl]-1H-indole.
| Compound Name | 5-[3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1H-pyrazol-5-yl]-1H-indole |
|---|---|
| PubChem CID | 171355591 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 5-[3-(3,4,5-trimethoxyphenyl)-4,5-dihydro-1H-pyrazol-5-yl]-1H-indole |
| SMILES | COc1cc(C2=NNC(c3ccc4[nH]ccc4c3)C2)cc(OC)c1OC |
| InChI | InChI=1S/C20H21N3O3/c1-24-18-9-14(10-19(25-2)20(18)26-3)17-11-16(22-23-17)12-4-5-15-13(8-12)6-7-21-15/h4-10,16,21-22H,11H2,1-3H3 |
| InChIKey | HVFPFCVBXBTGMR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |