C13H8N4O3S3 — CID 171355931
12,14-bis(sulfanylidene)-9-thiophen-2-yl-2-oxa-4,6,11,13-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-5,7-dione (PubChem CID 171355931) has the molecular formula C13H8N4O3S3 and a molecular weight of 364.43 g/mol. Its IUPAC name is 12,14-bis(sulfanylidene)-9-thiophen-2-yl-2-oxa-4,6,11,13-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-5,7-dione.
| Compound Name | 12,14-bis(sulfanylidene)-9-thiophen-2-yl-2-oxa-4,6,11,13-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-5,7-dione |
|---|---|
| PubChem CID | 171355931 |
| Molecular Formula | C13H8N4O3S3 |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 12,14-bis(sulfanylidene)-9-thiophen-2-yl-2-oxa-4,6,11,13-tetrazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8)-diene-5,7-dione |
| SMILES | O=c1[nH]c2c(c(=O)[nH]1)C(c1cccs1)c1[nH]c(=S)[nH]c(=S)c1O2 |
| InChI | InChI=1S/C13H8N4O3S3/c18-9-6-5(4-2-1-3-23-4)7-8(11(21)17-13(22)14-7)20-10(6)16-12(19)15-9/h1-3,5H,(H2,14,17,21,22)(H2,15,16,18,19) |
| InChIKey | NIQBRYBZDBPWLC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|