C22H26N4O9 — CID 171356001
1-[(2R,3R,4S,5S)-5-[(1S)-1-[(2R,3R,4S,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]oxy-3-(4-aminophenyl)prop-2-ynyl]-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 171356001) has the molecular formula C22H26N4O9 and a molecular weight of 490.47 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-5-[(1S)-1-[(2R,3R,4S,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]oxy-3-(4-aminophenyl)prop-2-ynyl]-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5S)-5-[(1S)-1-[(2R,3R,4S,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]oxy-3-(4-aminophenyl)prop-2-ynyl]-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171356001 |
| Molecular Formula | C22H26N4O9 |
| Molecular Weight | 490.47 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-5-[(1S)-1-[(2R,3R,4S,5R)-5-(aminomethyl)-3,4-dihydroxyoxolan-2-yl]oxy-3-(4-aminophenyl)prop-2-ynyl]-3,4-dihydroxyoxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | NC[C@H]1O[C@@H](O[C@@H](C#Cc2ccc(N)cc2)[C@H]2O[C@@H](n3ccc(=O)[nH]c3=O)[C@H](O)[C@@H]2O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H26N4O9/c23-9-13-15(28)18(31)21(34-13)33-12(6-3-10-1-4-11(24)5-2-10)19-16(29)17(30)20(35-19)26-8-7-14(27)25-22(26)32/h1-2,4-5,7-8,12-13,15-21,28-31H,9,23-24H2,(H,25,27,32)/t12-,13+,15+,16-,17+,18+,19+,20+,21+/m0/s1 |
| InChIKey | JFNFNBAEQNWITA-UHAWNKIKSA-N |
| XLogP | -3.42 |
| TPSA | 215.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.47 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|