C23H17NO4 — CID 171356035
7-(4-methoxyphenyl)-10,11-dihydro-9H-chromeno[4,3-b]quinoline-6,8-dione (PubChem CID 171356035) has the molecular formula C23H17NO4 and a molecular weight of 371.39 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-10,11-dihydro-9H-chromeno[4,3-b]quinoline-6,8-dione.
| Compound Name | 7-(4-methoxyphenyl)-10,11-dihydro-9H-chromeno[4,3-b]quinoline-6,8-dione |
|---|---|
| PubChem CID | 171356035 |
| Molecular Formula | C23H17NO4 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 7-(4-methoxyphenyl)-10,11-dihydro-9H-chromeno[4,3-b]quinoline-6,8-dione |
| SMILES | COc1ccc(-c2c3c(nc4c2c(=O)oc2ccccc24)CCCC3=O)cc1 |
| InChI | InChI=1S/C23H17NO4/c1-27-14-11-9-13(10-12-14)19-20-16(6-4-7-17(20)25)24-22-15-5-2-3-8-18(15)28-23(26)21(19)22/h2-3,5,8-12H,4,6-7H2,1H3 |
| InChIKey | ANIHQSLFHOANNK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|