C28H33N3O3 — CID 171356124
6-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[2-(2-methylphenyl)ethyl]indol-1-yl]-N-hydroxyhexanamide (PubChem CID 171356124) has the molecular formula C28H33N3O3 and a molecular weight of 459.59 g/mol. Its IUPAC name is 6-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[2-(2-methylphenyl)ethyl]indol-1-yl]-N-hydroxyhexanamide.
| Compound Name | 6-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[2-(2-methylphenyl)ethyl]indol-1-yl]-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 171356124 |
| Molecular Formula | C28H33N3O3 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 6-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-3-[2-(2-methylphenyl)ethyl]indol-1-yl]-N-hydroxyhexanamide |
| SMILES | Cc1ccccc1CCc1cn(CCCCCC(=O)NO)c2ccc(-c3c(C)noc3C)cc12 |
| InChI | InChI=1S/C28H33N3O3/c1-19-9-6-7-10-22(19)12-13-24-18-31(16-8-4-5-11-27(32)29-33)26-15-14-23(17-25(24)26)28-20(2)30-34-21(28)3/h6-7,9-10,14-15,17-18,33H,4-5,8,11-13,16H2,1-3H3,(H,29,32) |
| InChIKey | FSVKCBFELANYQU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 80.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|