About [2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate
[2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate (PubChem CID 171356185) has the molecular formula C14H17NO4
and a molecular weight of 263.29 g/mol. Its IUPAC name is [2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate.
Molecular Properties
| Compound Name | [2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate |
| PubChem CID | 171356185 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | [2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate |
| SMILES | CC(C)(C)NC(=O)COC(=O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO4/c1-14(2,3)15-11(16)9-19-13(18)12(17)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,15,16) |
| InChIKey | ODJJQMKNHAEFGU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze [2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate?
The IUPAC name of [2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate (CID 171356185) is [2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate.
What is the SMILES notation for [2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate?
The canonical SMILES for [2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate is CC(C)(C)NC(=O)COC(=O)C(=O)c1ccccc1.
What is the InChIKey of [2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate?
The InChIKey is ODJJQMKNHAEFGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO4/c1-14(2,3)15-11(16)9-19-13(18)12(17)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,15,16).
What are the key properties of [2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate?
[2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate has a molecular weight of 263.29 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(tert-butylamino)-2-oxoethyl] 2-oxo-2-phenylacetate is sourced from PubChem (CID 171356185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).